C10H10Br2N4O3 — CID 87921424
(2S,3R,5R)-5-(6,8-dibromopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 87921424) has the molecular formula C10H10Br2N4O3 and a molecular weight of 394.02 g/mol. Its IUPAC name is (2S,3R,5R)-5-(6,8-dibromopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2S,3R,5R)-5-(6,8-dibromopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 87921424 |
| Molecular Formula | C10H10Br2N4O3 |
| Molecular Weight | 394.02 g/mol |
| Exact Mass | 391.91 |
| IUPAC Name | (2S,3R,5R)-5-(6,8-dibromopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@@H]1O[C@@H](n2c(Br)nc3c(Br)ncnc32)C[C@H]1O |
| InChI | InChI=1S/C10H10Br2N4O3/c11-8-7-9(14-3-13-8)16(10(12)15-7)6-1-4(18)5(2-17)19-6/h3-6,17-18H,1-2H2/t4-,5+,6-/m1/s1 |
| InChIKey | XUSWHKORQXKNGA-NGJCXOISSA-N |
| XLogP | 0.99 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.02 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |