C32H24F6N8O4 — CID 87925782
2-(4-aminobenzimidazol-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide;2-(4-nitrobenzimidazol-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 87925782) has the molecular formula C32H24F6N8O4 and a molecular weight of 698.58 g/mol. Its IUPAC name is 2-(4-aminobenzimidazol-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide;2-(4-nitrobenzimidazol-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(4-aminobenzimidazol-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide;2-(4-nitrobenzimidazol-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 87925782 |
| Molecular Formula | C32H24F6N8O4 |
| Molecular Weight | 698.58 g/mol |
| Exact Mass | 698.18 |
| IUPAC Name | 2-(4-aminobenzimidazol-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide;2-(4-nitrobenzimidazol-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | Nc1cccc2c1ncn2CC(=O)Nc1cccc(C(F)(F)F)c1.O=C(Cn1cnc2c([N+](=O)[O-])cccc21)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H11F3N4O3.C16H13F3N4O/c17-16(18,19)10-3-1-4-11(7-10)21-14(24)8-22-9-20-15-12(22)5-2-6-13(15)23(25)26;17-16(18,19)10-3-1-4-11(7-10)22-14(24)8-23-9-21-15-12(20)5-2-6-13(15)23/h1-7,9H,8H2,(H,21,24);1-7,9H,8,20H2,(H,22,24) |
| InChIKey | VBCSUFRBYLHOCV-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 163.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.58 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|