C26H37NO5S — CID 87928727
(1S,3S,6E,10R,11S,12S,16R)-11-hydroxy-8,8,10,12-tetramethyl-3-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,17-dioxabicyclo[14.1.0]heptadec-6-ene-5,9-dione (PubChem CID 87928727) has the molecular formula C26H37NO5S and a molecular weight of 475.65 g/mol. Its IUPAC name is (1S,3S,6E,10R,11S,12S,16R)-11-hydroxy-8,8,10,12-tetramethyl-3-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,17-dioxabicyclo[14.1.0]heptadec-6-ene-5,9-dione.
| Compound Name | (1S,3S,6E,10R,11S,12S,16R)-11-hydroxy-8,8,10,12-tetramethyl-3-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,17-dioxabicyclo[14.1.0]heptadec-6-ene-5,9-dione |
|---|---|
| PubChem CID | 87928727 |
| Molecular Formula | C26H37NO5S |
| Molecular Weight | 475.65 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | (1S,3S,6E,10R,11S,12S,16R)-11-hydroxy-8,8,10,12-tetramethyl-3-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,17-dioxabicyclo[14.1.0]heptadec-6-ene-5,9-dione |
| SMILES | CC(=Cc1csc(C)n1)[C@@H]1C[C@@H]2O[C@@H]2CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)/C=C/C(=O)O1 |
| InChI | InChI=1S/C26H37NO5S/c1-15-8-7-9-20-22(31-20)13-21(16(2)12-19-14-33-18(4)27-19)32-23(28)10-11-26(5,6)25(30)17(3)24(15)29/h10-12,14-15,17,20-22,24,29H,7-9,13H2,1-6H3/b11-10+,16-12?/t15-,17+,20+,21-,22-,24-/m0/s1 |
| InChIKey | RVTOFYCXIURCAT-DGFUWRMDSA-N |
| XLogP | 4.89 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.65 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|