C27H39NO5S — CID 21341838
(6Z)-11-hydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,18-dioxabicyclo[14.2.0]octadec-6-ene-5,9-dione (PubChem CID 21341838) has the molecular formula C27H39NO5S and a molecular weight of 489.68 g/mol. Its IUPAC name is (6Z)-11-hydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,18-dioxabicyclo[14.2.0]octadec-6-ene-5,9-dione.
| Compound Name | (6Z)-11-hydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,18-dioxabicyclo[14.2.0]octadec-6-ene-5,9-dione |
|---|---|
| PubChem CID | 21341838 |
| Molecular Formula | C27H39NO5S |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | (6Z)-11-hydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,18-dioxabicyclo[14.2.0]octadec-6-ene-5,9-dione |
| SMILES | C/C(=C\c1csc(C)n1)C1CC2OCC2CCCC(C)C(O)C(C)C(=O)C(C)(C)/C=C\C(=O)O1 |
| InChI | InChI=1S/C27H39NO5S/c1-16-8-7-9-20-14-32-23(20)13-22(17(2)12-21-15-34-19(4)28-21)33-24(29)10-11-27(5,6)26(31)18(3)25(16)30/h10-12,15-16,18,20,22-23,25,30H,7-9,13-14H2,1-6H3/b11-10-,17-12+ |
| InChIKey | XXGYPXSNMNZRAJ-WUSHYMHTSA-N |
| XLogP | 5.14 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |