C27H38N4O5S — CID 91470272
(1S,3S,10R,11S,12S,16R)-3-[1-[2-(azidomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-11-hydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadec-6-ene-5,9-dione (PubChem CID 91470272) has the molecular formula C27H38N4O5S and a molecular weight of 530.69 g/mol. Its IUPAC name is (1S,3S,10R,11S,12S,16R)-3-[1-[2-(azidomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-11-hydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadec-6-ene-5,9-dione.
| Compound Name | (1S,3S,10R,11S,12S,16R)-3-[1-[2-(azidomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-11-hydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadec-6-ene-5,9-dione |
|---|---|
| PubChem CID | 91470272 |
| Molecular Formula | C27H38N4O5S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | (1S,3S,10R,11S,12S,16R)-3-[1-[2-(azidomethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-11-hydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadec-6-ene-5,9-dione |
| SMILES | CC(=Cc1csc(CN=[N+]=[N-])n1)[C@@H]1C[C@@H]2O[C@]2(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)C=CC(=O)O1 |
| InChI | InChI=1S/C27H38N4O5S/c1-16-8-7-10-27(6)21(36-27)13-20(17(2)12-19-15-37-22(30-19)14-29-31-28)35-23(32)9-11-26(4,5)25(34)18(3)24(16)33/h9,11-12,15-16,18,20-21,24,33H,7-8,10,13-14H2,1-6H3/t16-,18+,20-,21-,24-,27+/m0/s1 |
| InChIKey | NYYVGFHOKUBUAY-BXANONAUSA-N |
| XLogP | 5.78 |
| TPSA | 137.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|