C26H41NO5S — CID 91534385
(1S,3R,7R,10S,11R,12R,16S)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,17-dioxabicyclo[14.1.0]heptadecan-9-one (PubChem CID 91534385) has the molecular formula C26H41NO5S and a molecular weight of 479.68 g/mol. Its IUPAC name is (1S,3R,7R,10S,11R,12R,16S)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,17-dioxabicyclo[14.1.0]heptadecan-9-one.
| Compound Name | (1S,3R,7R,10S,11R,12R,16S)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,17-dioxabicyclo[14.1.0]heptadecan-9-one |
|---|---|
| PubChem CID | 91534385 |
| Molecular Formula | C26H41NO5S |
| Molecular Weight | 479.68 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | (1S,3R,7R,10S,11R,12R,16S)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,17-dioxabicyclo[14.1.0]heptadecan-9-one |
| SMILES | CC(=Cc1csc(C)n1)[C@H]1C[C@@H]2O[C@H]2CCC[C@@H](C)[C@@H](O)[C@H](C)C(=O)C(C)(C)[C@H](O)CCO1 |
| InChI | InChI=1S/C26H41NO5S/c1-15-8-7-9-20-22(32-20)13-21(16(2)12-19-14-33-18(4)27-19)31-11-10-23(28)26(5,6)25(30)17(3)24(15)29/h12,14-15,17,20-24,28-29H,7-11,13H2,1-6H3/t15-,17+,20+,21-,22+,23-,24-/m1/s1 |
| InChIKey | YYHKBHFITJFFMZ-PDQFINTRSA-N |
| XLogP | 4.56 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.68 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|