C15H27N3O3Si — CID 87932106
tert-butyl N-[(2R)-1-[cyano(cyclopropyl)amino]-1-oxo-3-trimethylsilylpropan-2-yl]carbamate (PubChem CID 87932106) has the molecular formula C15H27N3O3Si and a molecular weight of 325.49 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[cyano(cyclopropyl)amino]-1-oxo-3-trimethylsilylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[cyano(cyclopropyl)amino]-1-oxo-3-trimethylsilylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 87932106 |
| Molecular Formula | C15H27N3O3Si |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | tert-butyl N-[(2R)-1-[cyano(cyclopropyl)amino]-1-oxo-3-trimethylsilylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C[Si](C)(C)C)C(=O)N(C#N)C1CC1 |
| InChI | InChI=1S/C15H27N3O3Si/c1-15(2,3)21-14(20)17-12(9-22(4,5)6)13(19)18(10-16)11-7-8-11/h11-12H,7-9H2,1-6H3,(H,17,20)/t12-/m0/s1 |
| InChIKey | LZTZHJGNBKBRQI-LBPRGKRZSA-N |
| XLogP | 2.69 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|