C18H24N4O3S — CID 87879292
tert-butyl N-[1-[cyano(cyclopropyl)amino]-1-oxo-3-(pyridin-2-ylmethylsulfanyl)propan-2-yl]carbamate (PubChem CID 87879292) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is tert-butyl N-[1-[cyano(cyclopropyl)amino]-1-oxo-3-(pyridin-2-ylmethylsulfanyl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[cyano(cyclopropyl)amino]-1-oxo-3-(pyridin-2-ylmethylsulfanyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 87879292 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | tert-butyl N-[1-[cyano(cyclopropyl)amino]-1-oxo-3-(pyridin-2-ylmethylsulfanyl)propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CSCc1ccccn1)C(=O)N(C#N)C1CC1 |
| InChI | InChI=1S/C18H24N4O3S/c1-18(2,3)25-17(24)21-15(16(23)22(12-19)14-7-8-14)11-26-10-13-6-4-5-9-20-13/h4-6,9,14-15H,7-8,10-11H2,1-3H3,(H,21,24) |
| InChIKey | VJSJCPIPIDKOON-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|