C17H31N3O2S — CID 87933556
(2S,3S)-2-[[(2R)-2-amino-3-sulfanylpropyl]amino]-3-methylpentanoic acid;2-phenylethanamine (PubChem CID 87933556) has the molecular formula C17H31N3O2S and a molecular weight of 341.52 g/mol. Its IUPAC name is (2S,3S)-2-[[(2R)-2-amino-3-sulfanylpropyl]amino]-3-methylpentanoic acid;2-phenylethanamine.
| Compound Name | (2S,3S)-2-[[(2R)-2-amino-3-sulfanylpropyl]amino]-3-methylpentanoic acid;2-phenylethanamine |
|---|---|
| PubChem CID | 87933556 |
| Molecular Formula | C17H31N3O2S |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (2S,3S)-2-[[(2R)-2-amino-3-sulfanylpropyl]amino]-3-methylpentanoic acid;2-phenylethanamine |
| SMILES | CC[C@H](C)[C@H](NC[C@@H](N)CS)C(=O)O.NCCc1ccccc1 |
| InChI | InChI=1S/C9H20N2O2S.C8H11N/c1-3-6(2)8(9(12)13)11-4-7(10)5-14;9-7-6-8-4-2-1-3-5-8/h6-8,11,14H,3-5,10H2,1-2H3,(H,12,13);1-5H,6-7,9H2/t6-,7+,8-;/m0./s1 |
| InChIKey | YNGPQZFTOSRPNM-CZEXFEQNSA-N |
| XLogP | 1.52 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|