C20H35N3OS — CID 10021769
(2S,3S)-2-[[(2R)-2-amino-3-sulfanylpropyl]amino]-N-benzyl-N-butyl-3-methylpentanamide (PubChem CID 10021769) has the molecular formula C20H35N3OS and a molecular weight of 365.59 g/mol. Its IUPAC name is (2S,3S)-2-[[(2R)-2-amino-3-sulfanylpropyl]amino]-N-benzyl-N-butyl-3-methylpentanamide.
| Compound Name | (2S,3S)-2-[[(2R)-2-amino-3-sulfanylpropyl]amino]-N-benzyl-N-butyl-3-methylpentanamide |
|---|---|
| PubChem CID | 10021769 |
| Molecular Formula | C20H35N3OS |
| Molecular Weight | 365.59 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | (2S,3S)-2-[[(2R)-2-amino-3-sulfanylpropyl]amino]-N-benzyl-N-butyl-3-methylpentanamide |
| SMILES | CCCCN(Cc1ccccc1)C(=O)[C@@H](NC[C@@H](N)CS)[C@@H](C)CC |
| InChI | InChI=1S/C20H35N3OS/c1-4-6-12-23(14-17-10-8-7-9-11-17)20(24)19(16(3)5-2)22-13-18(21)15-25/h7-11,16,18-19,22,25H,4-6,12-15,21H2,1-3H3/t16-,18+,19-/m0/s1 |
| InChIKey | KNCNFHQKPFDTRS-UHOSZYNNSA-N |
| XLogP | 3.08 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|