C19H32ClN3O3 — CID 174331402
methyl N-[1-[aminomethyl(4-phenylbutyl)amino]-3-methyl-1-oxopentan-2-yl]carbamate;hydrochloride (PubChem CID 174331402) has the molecular formula C19H32ClN3O3 and a molecular weight of 385.94 g/mol. Its IUPAC name is methyl N-[1-[aminomethyl(4-phenylbutyl)amino]-3-methyl-1-oxopentan-2-yl]carbamate;hydrochloride.
| Compound Name | methyl N-[1-[aminomethyl(4-phenylbutyl)amino]-3-methyl-1-oxopentan-2-yl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 174331402 |
| Molecular Formula | C19H32ClN3O3 |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | methyl N-[1-[aminomethyl(4-phenylbutyl)amino]-3-methyl-1-oxopentan-2-yl]carbamate;hydrochloride |
| SMILES | CCC(C)C(NC(=O)OC)C(=O)N(CN)CCCCc1ccccc1.Cl |
| InChI | InChI=1S/C19H31N3O3.ClH/c1-4-15(2)17(21-19(24)25-3)18(23)22(14-20)13-9-8-12-16-10-6-5-7-11-16;/h5-7,10-11,15,17H,4,8-9,12-14,20H2,1-3H3,(H,21,24);1H |
| InChIKey | JPZRIRFWVJXQKJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|