C25H52N2O8S — CID 87933894
(Z,12R)-12-hydroxyoctadec-9-enoic acid;methyl sulfate;trimethyl-(propanoylamino)azanium (PubChem CID 87933894) has the molecular formula C25H52N2O8S and a molecular weight of 540.76 g/mol. Its IUPAC name is (Z,12R)-12-hydroxyoctadec-9-enoic acid;methyl sulfate;trimethyl-(propanoylamino)azanium.
| Compound Name | (Z,12R)-12-hydroxyoctadec-9-enoic acid;methyl sulfate;trimethyl-(propanoylamino)azanium |
|---|---|
| PubChem CID | 87933894 |
| Molecular Formula | C25H52N2O8S |
| Molecular Weight | 540.76 g/mol |
| Exact Mass | 540.34 |
| IUPAC Name | (Z,12R)-12-hydroxyoctadec-9-enoic acid;methyl sulfate;trimethyl-(propanoylamino)azanium |
| SMILES | CCC(=O)N[N+](C)(C)C.CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)O.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C18H34O3.C6H14N2O.CH4O4S/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;1-5-6(9)7-8(2,3)4;1-5-6(2,3)4/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21);5H2,1-4H3;1H3,(H,2,3,4)/b12-9-;;/t17-;;/m1../s1 |
| InChIKey | DXRQJMSXEOMRLZ-GKKIQAINSA-N |
| XLogP | 4.31 |
| TPSA | 153.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.76 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|