C23H50N2O7S — CID 175326238
amino(trimethyl)azanium;ethyl sulfate;(Z)-12-hydroxyoctadec-9-enoic acid (PubChem CID 175326238) has the molecular formula C23H50N2O7S and a molecular weight of 498.73 g/mol. Its IUPAC name is amino(trimethyl)azanium;ethyl sulfate;(Z)-12-hydroxyoctadec-9-enoic acid.
| Compound Name | amino(trimethyl)azanium;ethyl sulfate;(Z)-12-hydroxyoctadec-9-enoic acid |
|---|---|
| PubChem CID | 175326238 |
| Molecular Formula | C23H50N2O7S |
| Molecular Weight | 498.73 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | amino(trimethyl)azanium;ethyl sulfate;(Z)-12-hydroxyoctadec-9-enoic acid |
| SMILES | CCCCCCC(O)C/C=C\CCCCCCCC(=O)O.CCOS(=O)(=O)[O-].C[N+](C)(C)N |
| InChI | InChI=1S/C18H34O3.C3H11N2.C2H6O4S/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;1-5(2,3)4;1-2-6-7(3,4)5/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21);4H2,1-3H3;2H2,1H3,(H,3,4,5)/q;+1;/p-1/b12-9-;; |
| InChIKey | MDIKOOOTQAMXAH-AGZDHKJJSA-M |
| XLogP | 4.13 |
| TPSA | 149.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.73 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|