C13H18F2N2OS — CID 87936918
1-(2,4-difluorophenyl)-3-(3,3-dimethylbutan-2-yl)-1-sulfanylurea (PubChem CID 87936918) has the molecular formula C13H18F2N2OS and a molecular weight of 288.36 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(3,3-dimethylbutan-2-yl)-1-sulfanylurea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(3,3-dimethylbutan-2-yl)-1-sulfanylurea |
|---|---|
| PubChem CID | 87936918 |
| Molecular Formula | C13H18F2N2OS |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(3,3-dimethylbutan-2-yl)-1-sulfanylurea |
| SMILES | CC(NC(=O)N(S)c1ccc(F)cc1F)C(C)(C)C |
| InChI | InChI=1S/C13H18F2N2OS/c1-8(13(2,3)4)16-12(18)17(19)11-6-5-9(14)7-10(11)15/h5-8,19H,1-4H3,(H,16,18) |
| InChIKey | AJEOQBKCEVJNLP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|