C14H26F3NO — CID 87943208
N,N-diethyl-2-methyl-2-(trifluoromethyl)octanamide (PubChem CID 87943208) has the molecular formula C14H26F3NO and a molecular weight of 281.36 g/mol. Its IUPAC name is N,N-diethyl-2-methyl-2-(trifluoromethyl)octanamide.
| Compound Name | N,N-diethyl-2-methyl-2-(trifluoromethyl)octanamide |
|---|---|
| PubChem CID | 87943208 |
| Molecular Formula | C14H26F3NO |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | N,N-diethyl-2-methyl-2-(trifluoromethyl)octanamide |
| SMILES | CCCCCCC(C)(C(=O)N(CC)CC)C(F)(F)F |
| InChI | InChI=1S/C14H26F3NO/c1-5-8-9-10-11-13(4,14(15,16)17)12(19)18(6-2)7-3/h5-11H2,1-4H3 |
| InChIKey | LFKYDQHLJRVTJX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|