C16H20BrF3S — CID 87943393
2-tert-butyl-6-propyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromide (PubChem CID 87943393) has the molecular formula C16H20BrF3S and a molecular weight of 381.30 g/mol. Its IUPAC name is 2-tert-butyl-6-propyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromide.
| Compound Name | 2-tert-butyl-6-propyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromide |
|---|---|
| PubChem CID | 87943393 |
| Molecular Formula | C16H20BrF3S |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 2-tert-butyl-6-propyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromide |
| SMILES | CCCc1ccc2cc(C(C)(C)C)[s+](C(F)(F)F)c2c1.[Br-] |
| InChI | InChI=1S/C16H20F3S.BrH/c1-5-6-11-7-8-12-10-14(15(2,3)4)20(13(12)9-11)16(17,18)19;/h7-10H,5-6H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | HPTCJMSMDYIISW-UHFFFAOYSA-M |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|