C14H16BrF3O3S — CID 157374877
2-ethyl-6-propyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromate (PubChem CID 157374877) has the molecular formula C14H16BrF3O3S and a molecular weight of 401.24 g/mol. Its IUPAC name is 2-ethyl-6-propyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromate.
| Compound Name | 2-ethyl-6-propyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromate |
|---|---|
| PubChem CID | 157374877 |
| Molecular Formula | C14H16BrF3O3S |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | 2-ethyl-6-propyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromate |
| SMILES | CCCc1ccc2cc(CC)[s+](C(F)(F)F)c2c1.[O-][Br+2]([O-])[O-] |
| InChI | InChI=1S/C14H16F3S.BrO3/c1-3-5-10-6-7-11-9-12(4-2)18(13(11)8-10)14(15,16)17;2-1(3)4/h6-9H,3-5H2,1-2H3;/q+1;-1 |
| InChIKey | BKEZNRGZNXJBAI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|