C16H20BF7S — CID 87943157
6-tert-butyl-2-propyl-1-(trifluoromethyl)-1-benzothiophen-1-ium tetrafluoroborate (PubChem CID 87943157) has the molecular formula C16H20BF7S and a molecular weight of 388.20 g/mol. Its IUPAC name is 6-tert-butyl-2-propyl-1-(trifluoromethyl)-1-benzothiophen-1-ium tetrafluoroborate.
| Compound Name | 6-tert-butyl-2-propyl-1-(trifluoromethyl)-1-benzothiophen-1-ium tetrafluoroborate |
|---|---|
| PubChem CID | 87943157 |
| Molecular Formula | C16H20BF7S |
| Molecular Weight | 388.20 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 6-tert-butyl-2-propyl-1-(trifluoromethyl)-1-benzothiophen-1-ium tetrafluoroborate |
| SMILES | CCCc1cc2ccc(C(C)(C)C)cc2[s+]1C(F)(F)F.F[B-](F)(F)F |
| InChI | InChI=1S/C16H20F3S.BF4/c1-5-6-13-9-11-7-8-12(15(2,3)4)10-14(11)20(13)16(17,18)19;2-1(3,4)5/h7-10H,5-6H2,1-4H3;/q+1;-1 |
| InChIKey | DKPNKQNDQRJMMF-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.20 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|