C13H12F6O3S2 — CID 87943176
2-propyl-1-(trifluoromethyl)-1-benzothiophen-1-ium;trifluoromethanesulfonate (PubChem CID 87943176) has the molecular formula C13H12F6O3S2 and a molecular weight of 394.36 g/mol. Its IUPAC name is 2-propyl-1-(trifluoromethyl)-1-benzothiophen-1-ium;trifluoromethanesulfonate.
| Compound Name | 2-propyl-1-(trifluoromethyl)-1-benzothiophen-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87943176 |
| Molecular Formula | C13H12F6O3S2 |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 2-propyl-1-(trifluoromethyl)-1-benzothiophen-1-ium;trifluoromethanesulfonate |
| SMILES | CCCc1cc2ccccc2[s+]1C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C12H12F3S.CHF3O3S/c1-2-5-10-8-9-6-3-4-7-11(9)16(10)12(13,14)15;2-1(3,4)8(5,6)7/h3-4,6-8H,2,5H2,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | FMYMFKNGYFCKLS-UHFFFAOYSA-M |
| XLogP | 5.07 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|