C13H11O- — CID 87949356
cyclopenta-2,4-dien-1-ylidene-(2-methylphenyl)methanolate (PubChem CID 87949356) has the molecular formula C13H11O- and a molecular weight of 183.23 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-ylidene-(2-methylphenyl)methanolate.
| Compound Name | cyclopenta-2,4-dien-1-ylidene-(2-methylphenyl)methanolate |
|---|---|
| PubChem CID | 87949356 |
| Molecular Formula | C13H11O- |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | cyclopenta-2,4-dien-1-ylidene-(2-methylphenyl)methanolate |
| SMILES | Cc1ccccc1C([O-])=C1C=CC=C1 |
| InChI | InChI=1S/C13H12O/c1-10-6-2-5-9-12(10)13(14)11-7-3-4-8-11/h2-9,14H,1H3/p-1 |
| InChIKey | OPTALXMKAOTGET-UHFFFAOYSA-M |
| XLogP | 2.19 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|