C19H21N5O5S2 — CID 87949909
1-(3-nitrophenyl)-1-[(4-piperidin-1-ylsulfonylphenyl)carbamothioyl]urea (PubChem CID 87949909) has the molecular formula C19H21N5O5S2 and a molecular weight of 463.54 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-1-[(4-piperidin-1-ylsulfonylphenyl)carbamothioyl]urea.
| Compound Name | 1-(3-nitrophenyl)-1-[(4-piperidin-1-ylsulfonylphenyl)carbamothioyl]urea |
|---|---|
| PubChem CID | 87949909 |
| Molecular Formula | C19H21N5O5S2 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 1-(3-nitrophenyl)-1-[(4-piperidin-1-ylsulfonylphenyl)carbamothioyl]urea |
| SMILES | NC(=O)N(C(=S)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H21N5O5S2/c20-18(25)23(15-5-4-6-16(13-15)24(26)27)19(30)21-14-7-9-17(10-8-14)31(28,29)22-11-2-1-3-12-22/h4-10,13H,1-3,11-12H2,(H2,20,25)(H,21,30) |
| InChIKey | SHCSDBLBAZGIPR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 138.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|