C19H20BrClN4O3S2 — CID 87950044
1-(4-bromo-3-chlorophenyl)-1-[(4-piperidin-1-ylsulfonylphenyl)carbamothioyl]urea (PubChem CID 87950044) has the molecular formula C19H20BrClN4O3S2 and a molecular weight of 531.89 g/mol. Its IUPAC name is 1-(4-bromo-3-chlorophenyl)-1-[(4-piperidin-1-ylsulfonylphenyl)carbamothioyl]urea.
| Compound Name | 1-(4-bromo-3-chlorophenyl)-1-[(4-piperidin-1-ylsulfonylphenyl)carbamothioyl]urea |
|---|---|
| PubChem CID | 87950044 |
| Molecular Formula | C19H20BrClN4O3S2 |
| Molecular Weight | 531.89 g/mol |
| Exact Mass | 529.98 |
| IUPAC Name | 1-(4-bromo-3-chlorophenyl)-1-[(4-piperidin-1-ylsulfonylphenyl)carbamothioyl]urea |
| SMILES | NC(=O)N(C(=S)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1)c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C19H20BrClN4O3S2/c20-16-9-6-14(12-17(16)21)25(18(22)26)19(29)23-13-4-7-15(8-5-13)30(27,28)24-10-2-1-3-11-24/h4-9,12H,1-3,10-11H2,(H2,22,26)(H,23,29) |
| InChIKey | VUDXXMUGEPNFON-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.89 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|