C10H11ClO3 — CID 87951546
acetyl chloride;2,3-dimethoxybicyclo[2.2.0]hexa-1,3,5-triene (PubChem CID 87951546) has the molecular formula C10H11ClO3 and a molecular weight of 214.65 g/mol. Its IUPAC name is acetyl chloride;2,3-dimethoxybicyclo[2.2.0]hexa-1,3,5-triene.
| Compound Name | acetyl chloride;2,3-dimethoxybicyclo[2.2.0]hexa-1,3,5-triene |
|---|---|
| PubChem CID | 87951546 |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | acetyl chloride;2,3-dimethoxybicyclo[2.2.0]hexa-1,3,5-triene |
| SMILES | CC(=O)Cl.COc1c2ccc-2c1OC |
| InChI | InChI=1S/C8H8O2.C2H3ClO/c1-9-7-5-3-4-6(5)8(7)10-2;1-2(3)4/h3-4H,1-2H3;1H3 |
| InChIKey | DKMWVNVTLJYAKN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|