C23H31N3O2S — CID 87951606
5-[3-ethyl-6-(methoxymethyl)-5-(pentylamino)pyrazin-2-yl]-6-methoxy-2,3-dihydroindene-1-thione (PubChem CID 87951606) has the molecular formula C23H31N3O2S and a molecular weight of 413.59 g/mol. Its IUPAC name is 5-[3-ethyl-6-(methoxymethyl)-5-(pentylamino)pyrazin-2-yl]-6-methoxy-2,3-dihydroindene-1-thione.
| Compound Name | 5-[3-ethyl-6-(methoxymethyl)-5-(pentylamino)pyrazin-2-yl]-6-methoxy-2,3-dihydroindene-1-thione |
|---|---|
| PubChem CID | 87951606 |
| Molecular Formula | C23H31N3O2S |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 5-[3-ethyl-6-(methoxymethyl)-5-(pentylamino)pyrazin-2-yl]-6-methoxy-2,3-dihydroindene-1-thione |
| SMILES | CCCCCNc1nc(CC)c(-c2cc3c(cc2OC)C(=S)CC3)nc1COC |
| InChI | InChI=1S/C23H31N3O2S/c1-5-7-8-11-24-23-19(14-27-3)25-22(18(6-2)26-23)17-12-15-9-10-21(29)16(15)13-20(17)28-4/h12-13H,5-11,14H2,1-4H3,(H,24,26) |
| InChIKey | ALVFQLNQMXWLMH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|