C23H22FN3O6 — CID 87957137
1-(2-fluoro-4-nitrophenoxy)-3-[1-[4-(2-nitrophenyl)phenyl]ethylamino]propan-2-ol (PubChem CID 87957137) has the molecular formula C23H22FN3O6 and a molecular weight of 455.44 g/mol. Its IUPAC name is 1-(2-fluoro-4-nitrophenoxy)-3-[1-[4-(2-nitrophenyl)phenyl]ethylamino]propan-2-ol.
| Compound Name | 1-(2-fluoro-4-nitrophenoxy)-3-[1-[4-(2-nitrophenyl)phenyl]ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 87957137 |
| Molecular Formula | C23H22FN3O6 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 1-(2-fluoro-4-nitrophenoxy)-3-[1-[4-(2-nitrophenyl)phenyl]ethylamino]propan-2-ol |
| SMILES | CC(NCC(O)COc1ccc([N+](=O)[O-])cc1F)c1ccc(-c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H22FN3O6/c1-15(16-6-8-17(9-7-16)20-4-2-3-5-22(20)27(31)32)25-13-19(28)14-33-23-11-10-18(26(29)30)12-21(23)24/h2-12,15,19,25,28H,13-14H2,1H3 |
| InChIKey | JOQBLVSPXVPHJW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 127.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|