About [(E)-[amino-(4-methylphenyl)methylidene]amino] 2-ethylsulfanylbenzoate
[(E)-[amino-(4-methylphenyl)methylidene]amino] 2-ethylsulfanylbenzoate (PubChem CID 8795841) has the molecular formula C17H18N2O2S
and a molecular weight of 314.41 g/mol. Its IUPAC name is [(E)-[amino-(4-methylphenyl)methylidene]amino] 2-ethylsulfanylbenzoate.
Molecular Properties
| Compound Name | [(E)-[amino-(4-methylphenyl)methylidene]amino] 2-ethylsulfanylbenzoate |
| PubChem CID | 8795841 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [(E)-[amino-(4-methylphenyl)methylidene]amino] 2-ethylsulfanylbenzoate |
| SMILES | CCSc1ccccc1C(=O)O/N=C(/N)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H18N2O2S/c1-3-22-15-7-5-4-6-14(15)17(20)21-19-16(18)13-10-8-12(2)9-11-13/h4-11H,3H2,1-2H3,(H2,18,19) |
| InChIKey | RCEPRFWFKGLEOO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[amino-(4-methylphenyl)methylidene]amino] 2-ethylsulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[amino-(4-methylphenyl)methylidene]amino] 2-ethylsulfanylbenzoate?
The IUPAC name of [(E)-[amino-(4-methylphenyl)methylidene]amino] 2-ethylsulfanylbenzoate (CID 8795841) is [(E)-[amino-(4-methylphenyl)methylidene]amino] 2-ethylsulfanylbenzoate.
What is the SMILES notation for [(E)-[amino-(4-methylphenyl)methylidene]amino] 2-ethylsulfanylbenzoate?
The canonical SMILES for [(E)-[amino-(4-methylphenyl)methylidene]amino] 2-ethylsulfanylbenzoate is CCSc1ccccc1C(=O)O/N=C(/N)c1ccc(C)cc1.
What is the InChIKey of [(E)-[amino-(4-methylphenyl)methylidene]amino] 2-ethylsulfanylbenzoate?
The InChIKey is RCEPRFWFKGLEOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O2S/c1-3-22-15-7-5-4-6-14(15)17(20)21-19-16(18)13-10-8-12(2)9-11-13/h4-11H,3H2,1-2H3,(H2,18,19).
What are the key properties of [(E)-[amino-(4-methylphenyl)methylidene]amino] 2-ethylsulfanylbenzoate?
[(E)-[amino-(4-methylphenyl)methylidene]amino] 2-ethylsulfanylbenzoate has a molecular weight of 314.41 g/mol, XLogP of 3.58, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[amino-(4-methylphenyl)methylidene]amino] 2-ethylsulfanylbenzoate is sourced from PubChem (CID 8795841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).