C27H27N3O9S — CID 87963282
2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(5-nitro-1-benzofuran-2-carbonyl)amino]naphthalen-1-yl]ethyl methanesulfonate (PubChem CID 87963282) has the molecular formula C27H27N3O9S and a molecular weight of 569.59 g/mol. Its IUPAC name is 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(5-nitro-1-benzofuran-2-carbonyl)amino]naphthalen-1-yl]ethyl methanesulfonate.
| Compound Name | 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(5-nitro-1-benzofuran-2-carbonyl)amino]naphthalen-1-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 87963282 |
| Molecular Formula | C27H27N3O9S |
| Molecular Weight | 569.59 g/mol |
| Exact Mass | 569.15 |
| IUPAC Name | 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(5-nitro-1-benzofuran-2-carbonyl)amino]naphthalen-1-yl]ethyl methanesulfonate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(NC(=O)c2cc3cc([N+](=O)[O-])ccc3o2)c(CCOS(C)(=O)=O)c2ccccc12 |
| InChI | InChI=1S/C27H27N3O9S/c1-27(2,3)39-26(32)29-22-15-21(20(11-12-37-40(4,35)36)18-7-5-6-8-19(18)22)28-25(31)24-14-16-13-17(30(33)34)9-10-23(16)38-24/h5-10,13-15H,11-12H2,1-4H3,(H,28,31)(H,29,32) |
| InChIKey | VAPWYPXVAUCZDH-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 167.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|