C26H26ClN3O4 — CID 70036797
tert-butyl N-[3-[(5-amino-1-benzofuran-2-carbonyl)amino]-4-(2-chloroethyl)naphthalen-1-yl]carbamate (PubChem CID 70036797) has the molecular formula C26H26ClN3O4 and a molecular weight of 479.96 g/mol. Its IUPAC name is tert-butyl N-[3-[(5-amino-1-benzofuran-2-carbonyl)amino]-4-(2-chloroethyl)naphthalen-1-yl]carbamate.
| Compound Name | tert-butyl N-[3-[(5-amino-1-benzofuran-2-carbonyl)amino]-4-(2-chloroethyl)naphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 70036797 |
| Molecular Formula | C26H26ClN3O4 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | tert-butyl N-[3-[(5-amino-1-benzofuran-2-carbonyl)amino]-4-(2-chloroethyl)naphthalen-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(NC(=O)c2cc3cc(N)ccc3o2)c(CCCl)c2ccccc12 |
| InChI | InChI=1S/C26H26ClN3O4/c1-26(2,3)34-25(32)30-21-14-20(19(10-11-27)17-6-4-5-7-18(17)21)29-24(31)23-13-15-12-16(28)8-9-22(15)33-23/h4-9,12-14H,10-11,28H2,1-3H3,(H,29,31)(H,30,32) |
| InChIKey | XLKINOHRIRPDEI-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|