C22H27N3O3 — CID 87966185
2-[3-[4-[(2-methylquinolin-4-yl)methoxy]piperidin-1-yl]-2-oxopyrrolidin-1-yl]acetaldehyde (PubChem CID 87966185) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-[3-[4-[(2-methylquinolin-4-yl)methoxy]piperidin-1-yl]-2-oxopyrrolidin-1-yl]acetaldehyde.
| Compound Name | 2-[3-[4-[(2-methylquinolin-4-yl)methoxy]piperidin-1-yl]-2-oxopyrrolidin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 87966185 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 2-[3-[4-[(2-methylquinolin-4-yl)methoxy]piperidin-1-yl]-2-oxopyrrolidin-1-yl]acetaldehyde |
| SMILES | Cc1cc(COC2CCN(C3CCN(CC=O)C3=O)CC2)c2ccccc2n1 |
| InChI | InChI=1S/C22H27N3O3/c1-16-14-17(19-4-2-3-5-20(19)23-16)15-28-18-6-9-24(10-7-18)21-8-11-25(12-13-26)22(21)27/h2-5,13-14,18,21H,6-12,15H2,1H3 |
| InChIKey | MSEAILOIMCGSBX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|