C22H18N4O2S — CID 8797035
4-cyano-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-2-methyl-5-pyrrol-1-ylfuran-3-carboxamide (PubChem CID 8797035) has the molecular formula C22H18N4O2S and a molecular weight of 402.48 g/mol. Its IUPAC name is 4-cyano-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-2-methyl-5-pyrrol-1-ylfuran-3-carboxamide.
| Compound Name | 4-cyano-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-2-methyl-5-pyrrol-1-ylfuran-3-carboxamide |
|---|---|
| PubChem CID | 8797035 |
| Molecular Formula | C22H18N4O2S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 4-cyano-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-2-methyl-5-pyrrol-1-ylfuran-3-carboxamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)c3c(C)oc(-n4cccc4)c3C#N)n2)cc1C |
| InChI | InChI=1S/C22H18N4O2S/c1-13-6-7-16(10-14(13)2)18-12-29-22(24-18)25-20(27)19-15(3)28-21(17(19)11-23)26-8-4-5-9-26/h4-10,12H,1-3H3,(H,24,25,27) |
| InChIKey | XLGJRMXBKZCDGQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 83.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_F(5)', 'substructure': 'N/A'} |
|---|