C15H19NO4 — CID 87973015
methyl 2-[(5-hydroperoxy-1H-indol-3-yl)methyl]pentanoate (PubChem CID 87973015) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is methyl 2-[(5-hydroperoxy-1H-indol-3-yl)methyl]pentanoate.
| Compound Name | methyl 2-[(5-hydroperoxy-1H-indol-3-yl)methyl]pentanoate |
|---|---|
| PubChem CID | 87973015 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | methyl 2-[(5-hydroperoxy-1H-indol-3-yl)methyl]pentanoate |
| SMILES | CCCC(Cc1c[nH]c2ccc(OO)cc12)C(=O)OC |
| InChI | InChI=1S/C15H19NO4/c1-3-4-10(15(17)19-2)7-11-9-16-14-6-5-12(20-18)8-13(11)14/h5-6,8-10,16,18H,3-4,7H2,1-2H3 |
| InChIKey | ZSWAWPPITHTOSQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|