C29H32O6 — CID 87975407
(5-hydroxy-2-methylidenepentanoyl) 3-benzyl-2-methylidene-5-phenylpent-4-enoate;2-methylprop-2-enoic acid (PubChem CID 87975407) has the molecular formula C29H32O6 and a molecular weight of 476.57 g/mol. Its IUPAC name is (5-hydroxy-2-methylidenepentanoyl) 3-benzyl-2-methylidene-5-phenylpent-4-enoate;2-methylprop-2-enoic acid.
| Compound Name | (5-hydroxy-2-methylidenepentanoyl) 3-benzyl-2-methylidene-5-phenylpent-4-enoate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 87975407 |
| Molecular Formula | C29H32O6 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | (5-hydroxy-2-methylidenepentanoyl) 3-benzyl-2-methylidene-5-phenylpent-4-enoate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=C(CCCO)C(=O)OC(=O)C(=C)C(C=Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H26O4.C4H6O2/c1-19(10-9-17-26)24(27)29-25(28)20(2)23(18-22-13-7-4-8-14-22)16-15-21-11-5-3-6-12-21;1-3(2)4(5)6/h3-8,11-16,23,26H,1-2,9-10,17-18H2;1H2,2H3,(H,5,6) |
| InChIKey | AJJHZCAQXYPANE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|