C27H34O9 — CID 89457385
[3-hydroxy-2-(2-methyl-3-phenylprop-2-enoyl)oxypropyl] 5-hydroxy-2-methylidenepentanoate;2-methylprop-2-enoyl 2-methylprop-2-enoate (PubChem CID 89457385) has the molecular formula C27H34O9 and a molecular weight of 502.56 g/mol. Its IUPAC name is [3-hydroxy-2-(2-methyl-3-phenylprop-2-enoyl)oxypropyl] 5-hydroxy-2-methylidenepentanoate;2-methylprop-2-enoyl 2-methylprop-2-enoate.
| Compound Name | [3-hydroxy-2-(2-methyl-3-phenylprop-2-enoyl)oxypropyl] 5-hydroxy-2-methylidenepentanoate;2-methylprop-2-enoyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89457385 |
| Molecular Formula | C27H34O9 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | [3-hydroxy-2-(2-methyl-3-phenylprop-2-enoyl)oxypropyl] 5-hydroxy-2-methylidenepentanoate;2-methylprop-2-enoyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(=O)C(=C)C.C=C(CCCO)C(=O)OCC(CO)OC(=O)C(C)=Cc1ccccc1 |
| InChI | InChI=1S/C19H24O6.C8H10O3/c1-14(7-6-10-20)18(22)24-13-17(12-21)25-19(23)15(2)11-16-8-4-3-5-9-16;1-5(2)7(9)11-8(10)6(3)4/h3-5,8-9,11,17,20-21H,1,6-7,10,12-13H2,2H3;1,3H2,2,4H3 |
| InChIKey | ZBHJGNKATWVUAQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|