C30H32O10 — CID 130395132
bis[1-hydroxy-3-(2-methylprop-2-enoyloxy)propan-2-yl] 2,3-bis(ethenyl)naphthalene-1,4-dicarboxylate (PubChem CID 130395132) has the molecular formula C30H32O10 and a molecular weight of 552.58 g/mol. Its IUPAC name is bis[1-hydroxy-3-(2-methylprop-2-enoyloxy)propan-2-yl] 2,3-bis(ethenyl)naphthalene-1,4-dicarboxylate.
| Compound Name | bis[1-hydroxy-3-(2-methylprop-2-enoyloxy)propan-2-yl] 2,3-bis(ethenyl)naphthalene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 130395132 |
| Molecular Formula | C30H32O10 |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | bis[1-hydroxy-3-(2-methylprop-2-enoyloxy)propan-2-yl] 2,3-bis(ethenyl)naphthalene-1,4-dicarboxylate |
| SMILES | C=Cc1c(C=C)c(C(=O)OC(CO)COC(=O)C(=C)C)c2ccccc2c1C(=O)OC(CO)COC(=O)C(=C)C |
| InChI | InChI=1S/C30H32O10/c1-7-21-22(8-2)26(30(36)40-20(14-32)16-38-28(34)18(5)6)24-12-10-9-11-23(24)25(21)29(35)39-19(13-31)15-37-27(33)17(3)4/h7-12,19-20,31-32H,1-3,5,13-16H2,4,6H3 |
| InChIKey | CTPWWSCEZPJISJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|