C16H20O — CID 87976162
1-(3-cyclopenta-1,4-dien-1-ylpropyl)-2-ethoxybenzene (PubChem CID 87976162) has the molecular formula C16H20O and a molecular weight of 228.33 g/mol. Its IUPAC name is 1-(3-cyclopenta-1,4-dien-1-ylpropyl)-2-ethoxybenzene.
| Compound Name | 1-(3-cyclopenta-1,4-dien-1-ylpropyl)-2-ethoxybenzene |
|---|---|
| PubChem CID | 87976162 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 1-(3-cyclopenta-1,4-dien-1-ylpropyl)-2-ethoxybenzene |
| SMILES | CCOc1ccccc1CCCC1=CCC=C1 |
| InChI | InChI=1S/C16H20O/c1-2-17-16-13-6-5-11-15(16)12-7-10-14-8-3-4-9-14/h3,5-6,8-9,11,13H,2,4,7,10,12H2,1H3 |
| InChIKey | JDDADIQPYOUKBG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |