C17H22 — CID 173364149
1-(cyclopenta-1,4-dien-1-ylmethyl)-2-pentylbenzene (PubChem CID 173364149) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-(cyclopenta-1,4-dien-1-ylmethyl)-2-pentylbenzene.
| Compound Name | 1-(cyclopenta-1,4-dien-1-ylmethyl)-2-pentylbenzene |
|---|---|
| PubChem CID | 173364149 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1-(cyclopenta-1,4-dien-1-ylmethyl)-2-pentylbenzene |
| SMILES | CCCCCc1ccccc1CC1=CCC=C1 |
| InChI | InChI=1S/C17H22/c1-2-3-4-11-16-12-7-8-13-17(16)14-15-9-5-6-10-15/h5,7-10,12-13H,2-4,6,11,14H2,1H3 |
| InChIKey | GNWUEQPQTZZGHR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|