C19H30OSi — CID 87976344
(1-butoxy-2,4-dimethylcyclohexa-2,4-dien-1-yl)-cyclopenta-1,4-dien-1-yl-dimethylsilane (PubChem CID 87976344) has the molecular formula C19H30OSi and a molecular weight of 302.53 g/mol. Its IUPAC name is (1-butoxy-2,4-dimethylcyclohexa-2,4-dien-1-yl)-cyclopenta-1,4-dien-1-yl-dimethylsilane.
| Compound Name | (1-butoxy-2,4-dimethylcyclohexa-2,4-dien-1-yl)-cyclopenta-1,4-dien-1-yl-dimethylsilane |
|---|---|
| PubChem CID | 87976344 |
| Molecular Formula | C19H30OSi |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | (1-butoxy-2,4-dimethylcyclohexa-2,4-dien-1-yl)-cyclopenta-1,4-dien-1-yl-dimethylsilane |
| SMILES | CCCCOC1([Si](C)(C)C2=CCC=C2)CC=C(C)C=C1C |
| InChI | InChI=1S/C19H30OSi/c1-6-7-14-20-19(13-12-16(2)15-17(19)3)21(4,5)18-10-8-9-11-18/h8,10-12,15H,6-7,9,13-14H2,1-5H3 |
| InChIKey | JAJAOALTLSWAFF-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|