C19H22ClF3N2O — CID 87977971
N-[(6-chloro-3-pyridinyl)methyl]-N,2-dimethyl-4-[3-(trifluoromethoxy)phenyl]butan-1-amine (PubChem CID 87977971) has the molecular formula C19H22ClF3N2O and a molecular weight of 386.85 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)methyl]-N,2-dimethyl-4-[3-(trifluoromethoxy)phenyl]butan-1-amine.
| Compound Name | N-[(6-chloro-3-pyridinyl)methyl]-N,2-dimethyl-4-[3-(trifluoromethoxy)phenyl]butan-1-amine |
|---|---|
| PubChem CID | 87977971 |
| Molecular Formula | C19H22ClF3N2O |
| Molecular Weight | 386.85 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)methyl]-N,2-dimethyl-4-[3-(trifluoromethoxy)phenyl]butan-1-amine |
| SMILES | CC(CCc1cccc(OC(F)(F)F)c1)CN(C)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C19H22ClF3N2O/c1-14(12-25(2)13-16-8-9-18(20)24-11-16)6-7-15-4-3-5-17(10-15)26-19(21,22)23/h3-5,8-11,14H,6-7,12-13H2,1-2H3 |
| InChIKey | IRWDVUNJVZABGH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.85 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|