hydrogen sulfate;4-(N-methoxyanilino)benzenediazonium

C13H13N3O5S — CID 87981415

IUPAChydrogen sulfate;4-(N-methoxyanilino)benzenediazonium
SMILESCON(c1ccccc1)c1ccc([N+]#N)cc1.O=S(=O)([O-])O
InChIInChI=1S/C13H12N3O.H2O4S/c1-17-16(12-5-3-2-4-6-12)13-9-7-11(15-14)8-10-13;1-5(2,3)4/h2-10H,1H3;(H2,1,2,3,4)/q+1;/p-1
InChIKeyYRFKWMMAFFECQB-UHFFFAOYSA-M
MW323.33 g/mol
LogP2.88
Rot. Bonds3

About hydrogen sulfate;4-(N-methoxyanilino)benzenediazonium

hydrogen sulfate;4-(N-methoxyanilino)benzenediazonium (PubChem CID 87981415) has the molecular formula C13H13N3O5S and a molecular weight of 323.33 g/mol. Its IUPAC name is hydrogen sulfate;4-(N-methoxyanilino)benzenediazonium.

Molecular Properties

Compound Namehydrogen sulfate;4-(N-methoxyanilino)benzenediazonium
PubChem CID87981415
Molecular FormulaC13H13N3O5S
Molecular Weight323.33 g/mol
Exact Mass323.06
IUPAC Namehydrogen sulfate;4-(N-methoxyanilino)benzenediazonium
SMILESCON(c1ccccc1)c1ccc([N+]#N)cc1.O=S(=O)([O-])O
InChIInChI=1S/C13H12N3O.H2O4S/c1-17-16(12-5-3-2-4-6-12)13-9-7-11(15-14)8-10-13;1-5(2,3)4/h2-10H,1H3;(H2,1,2,3,4)/q+1;/p-1
InChIKeyYRFKWMMAFFECQB-UHFFFAOYSA-M
XLogP2.88
TPSA118.05 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500323.33
LogP ≤ 52.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'}

Analyze hydrogen sulfate;4-(N-methoxyanilino)benzenediazonium with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrogen sulfate;4-(N-methoxyanilino)benzenediazonium?
The IUPAC name of hydrogen sulfate;4-(N-methoxyanilino)benzenediazonium (CID 87981415) is hydrogen sulfate;4-(N-methoxyanilino)benzenediazonium.
What is the SMILES notation for hydrogen sulfate;4-(N-methoxyanilino)benzenediazonium?
The canonical SMILES for hydrogen sulfate;4-(N-methoxyanilino)benzenediazonium is CON(c1ccccc1)c1ccc([N+]#N)cc1.O=S(=O)([O-])O.
What is the InChIKey of hydrogen sulfate;4-(N-methoxyanilino)benzenediazonium?
The InChIKey is YRFKWMMAFFECQB-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H12N3O.H2O4S/c1-17-16(12-5-3-2-4-6-12)13-9-7-11(15-14)8-10-13;1-5(2,3)4/h2-10H,1H3;(H2,1,2,3,4)/q+1;/p-1.
What are the key properties of hydrogen sulfate;4-(N-methoxyanilino)benzenediazonium?
hydrogen sulfate;4-(N-methoxyanilino)benzenediazonium has a molecular weight of 323.33 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen sulfate;4-(N-methoxyanilino)benzenediazonium is sourced from PubChem (CID 87981415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).