About ethoxyethane;methyl(methylsulfonyl)phosphinic acid
ethoxyethane;methyl(methylsulfonyl)phosphinic acid (PubChem CID 87983558) has the molecular formula C6H17O5PS
and a molecular weight of 232.24 g/mol. Its IUPAC name is ethoxyethane;methyl(methylsulfonyl)phosphinic acid.
Molecular Properties
| Compound Name | ethoxyethane;methyl(methylsulfonyl)phosphinic acid |
| PubChem CID | 87983558 |
| Molecular Formula | C6H17O5PS |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | ethoxyethane;methyl(methylsulfonyl)phosphinic acid |
| SMILES | CCOCC.CP(=O)(O)S(C)(=O)=O |
| InChI | InChI=1S/C4H10O.C2H7O4PS/c1-3-5-4-2;1-7(3,4)8(2,5)6/h3-4H2,1-2H3;1-2H3,(H,3,4) |
| InChIKey | KMAMFGPGEXLKKM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethoxyethane;methyl(methylsulfonyl)phosphinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;methyl(methylsulfonyl)phosphinic acid?
The IUPAC name of ethoxyethane;methyl(methylsulfonyl)phosphinic acid (CID 87983558) is ethoxyethane;methyl(methylsulfonyl)phosphinic acid.
What is the SMILES notation for ethoxyethane;methyl(methylsulfonyl)phosphinic acid?
The canonical SMILES for ethoxyethane;methyl(methylsulfonyl)phosphinic acid is CCOCC.CP(=O)(O)S(C)(=O)=O.
What is the InChIKey of ethoxyethane;methyl(methylsulfonyl)phosphinic acid?
The InChIKey is KMAMFGPGEXLKKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O.C2H7O4PS/c1-3-5-4-2;1-7(3,4)8(2,5)6/h3-4H2,1-2H3;1-2H3,(H,3,4).
What are the key properties of ethoxyethane;methyl(methylsulfonyl)phosphinic acid?
ethoxyethane;methyl(methylsulfonyl)phosphinic acid has a molecular weight of 232.24 g/mol, XLogP of 0.89, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;methyl(methylsulfonyl)phosphinic acid is sourced from PubChem (CID 87983558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).