About benzyl(triphenyl)phosphanium;fluoro butanoate
benzyl(triphenyl)phosphanium;fluoro butanoate (PubChem CID 87986174) has the molecular formula C29H29FO2P+
and a molecular weight of 459.52 g/mol. Its IUPAC name is benzyl(triphenyl)phosphanium;fluoro butanoate.
Molecular Properties
| Compound Name | benzyl(triphenyl)phosphanium;fluoro butanoate |
| PubChem CID | 87986174 |
| Molecular Formula | C29H29FO2P+ |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | benzyl(triphenyl)phosphanium;fluoro butanoate |
| SMILES | CCCC(=O)OF.c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22P.C4H7FO2/c1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;1-2-3-4(6)7-5/h1-20H,21H2;2-3H2,1H3/q+1; |
| InChIKey | KYSBAORYRKDFHL-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzyl(triphenyl)phosphanium;fluoro butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(triphenyl)phosphanium;fluoro butanoate?
The IUPAC name of benzyl(triphenyl)phosphanium;fluoro butanoate (CID 87986174) is benzyl(triphenyl)phosphanium;fluoro butanoate.
What is the SMILES notation for benzyl(triphenyl)phosphanium;fluoro butanoate?
The canonical SMILES for benzyl(triphenyl)phosphanium;fluoro butanoate is CCCC(=O)OF.c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of benzyl(triphenyl)phosphanium;fluoro butanoate?
The InChIKey is KYSBAORYRKDFHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22P.C4H7FO2/c1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;1-2-3-4(6)7-5/h1-20H,21H2;2-3H2,1H3/q+1;.
What are the key properties of benzyl(triphenyl)phosphanium;fluoro butanoate?
benzyl(triphenyl)phosphanium;fluoro butanoate has a molecular weight of 459.52 g/mol, XLogP of 6.39, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(triphenyl)phosphanium;fluoro butanoate is sourced from PubChem (CID 87986174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).