About 3-ethoxy-1-naphthalen-1-ylthiolan-1-ium;octane-1-sulfonate
3-ethoxy-1-naphthalen-1-ylthiolan-1-ium;octane-1-sulfonate (PubChem CID 87986670) has the molecular formula C24H36O4S2
and a molecular weight of 452.68 g/mol. Its IUPAC name is 3-ethoxy-1-naphthalen-1-ylthiolan-1-ium;octane-1-sulfonate.
Molecular Properties
| Compound Name | 3-ethoxy-1-naphthalen-1-ylthiolan-1-ium;octane-1-sulfonate |
| PubChem CID | 87986670 |
| Molecular Formula | C24H36O4S2 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 3-ethoxy-1-naphthalen-1-ylthiolan-1-ium;octane-1-sulfonate |
| SMILES | CCCCCCCCS(=O)(=O)[O-].CCOC1CC[S+](c2cccc3ccccc23)C1 |
| InChI | InChI=1S/C16H19OS.C8H18O3S/c1-2-17-14-10-11-18(12-14)16-9-5-7-13-6-3-4-8-15(13)16;1-2-3-4-5-6-7-8-12(9,10)11/h3-9,14H,2,10-12H2,1H3;2-8H2,1H3,(H,9,10,11)/q+1;/p-1 |
| InChIKey | ZNPCJWBJOFZWFX-UHFFFAOYSA-M |
| XLogP | 5.52 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-1-naphthalen-1-ylthiolan-1-ium;octane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-1-naphthalen-1-ylthiolan-1-ium;octane-1-sulfonate?
The IUPAC name of 3-ethoxy-1-naphthalen-1-ylthiolan-1-ium;octane-1-sulfonate (CID 87986670) is 3-ethoxy-1-naphthalen-1-ylthiolan-1-ium;octane-1-sulfonate.
What is the SMILES notation for 3-ethoxy-1-naphthalen-1-ylthiolan-1-ium;octane-1-sulfonate?
The canonical SMILES for 3-ethoxy-1-naphthalen-1-ylthiolan-1-ium;octane-1-sulfonate is CCCCCCCCS(=O)(=O)[O-].CCOC1CC[S+](c2cccc3ccccc23)C1.
What is the InChIKey of 3-ethoxy-1-naphthalen-1-ylthiolan-1-ium;octane-1-sulfonate?
The InChIKey is ZNPCJWBJOFZWFX-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H19OS.C8H18O3S/c1-2-17-14-10-11-18(12-14)16-9-5-7-13-6-3-4-8-15(13)16;1-2-3-4-5-6-7-8-12(9,10)11/h3-9,14H,2,10-12H2,1H3;2-8H2,1H3,(H,9,10,11)/q+1;/p-1.
What are the key properties of 3-ethoxy-1-naphthalen-1-ylthiolan-1-ium;octane-1-sulfonate?
3-ethoxy-1-naphthalen-1-ylthiolan-1-ium;octane-1-sulfonate has a molecular weight of 452.68 g/mol, XLogP of 5.52, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-1-naphthalen-1-ylthiolan-1-ium;octane-1-sulfonate is sourced from PubChem (CID 87986670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).