C12H9ClF3NO4 — CID 87988242
6-chloro-8-[(Z)-hydroxyiminomethyl]-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid (PubChem CID 87988242) has the molecular formula C12H9ClF3NO4 and a molecular weight of 323.65 g/mol. Its IUPAC name is 6-chloro-8-[(Z)-hydroxyiminomethyl]-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid.
| Compound Name | 6-chloro-8-[(Z)-hydroxyiminomethyl]-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 87988242 |
| Molecular Formula | C12H9ClF3NO4 |
| Molecular Weight | 323.65 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 6-chloro-8-[(Z)-hydroxyiminomethyl]-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1Cc2cc(Cl)cc(/C=N\O)c2OC1C(F)(F)F |
| InChI | InChI=1S/C12H9ClF3NO4/c13-7-1-5-3-8(11(18)19)10(12(14,15)16)21-9(5)6(2-7)4-17-20/h1-2,4,8,10,20H,3H2,(H,18,19)/b17-4- |
| InChIKey | FIIBHSNOXGSBIY-INGKJJEOSA-N |
| XLogP | 2.71 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.65 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|