C3H2ClN3O2S — CID 87990452
5-chloro-3-sulfonyl-2H-1,2,4-triazine (PubChem CID 87990452) has the molecular formula C3H2ClN3O2S and a molecular weight of 179.59 g/mol. Its IUPAC name is 5-chloro-3-sulfonyl-2H-1,2,4-triazine.
| Compound Name | 5-chloro-3-sulfonyl-2H-1,2,4-triazine |
|---|---|
| PubChem CID | 87990452 |
| Molecular Formula | C3H2ClN3O2S |
| Molecular Weight | 179.59 g/mol |
| Exact Mass | 178.96 |
| IUPAC Name | 5-chloro-3-sulfonyl-2H-1,2,4-triazine |
| SMILES | O=S(=O)=c1nc(Cl)cn[nH]1 |
| InChI | InChI=1S/C3H2ClN3O2S/c4-2-1-5-7-3(6-2)10(8)9/h1,7H |
| InChIKey | IUDFVKWDVWDSHV-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.59 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|