About CID 87991691
CID 87991691 (PubChem CID 87991691) has the molecular formula C16H34Sn+
and a molecular weight of 345.16 g/mol.
Molecular Properties
| Compound Name | CID 87991691 |
| PubChem CID | 87991691 |
| Molecular Formula | C16H34Sn+ |
| Molecular Weight | 345.16 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | — |
| SMILES | CCCCC(CC)C[Sn+]CC(CC)CCCC |
| InChI | InChI=1S/2C8H17.Sn/c2*1-4-6-7-8(3)5-2;/h2*8H,3-7H2,1-2H3;/q;;+1 |
| InChIKey | MZJCMFZTBKIDRO-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.16 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 87991691 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87991691?
The IUPAC name of CID 87991691 (CID 87991691) is not available.
What is the SMILES notation for CID 87991691?
The canonical SMILES for CID 87991691 is CCCCC(CC)C[Sn+]CC(CC)CCCC.
What is the InChIKey of CID 87991691?
The InChIKey is MZJCMFZTBKIDRO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H17.Sn/c2*1-4-6-7-8(3)5-2;/h2*8H,3-7H2,1-2H3;/q;;+1.
What are the key properties of CID 87991691?
CID 87991691 has a molecular weight of 345.16 g/mol, XLogP of 5.96, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87991691 is sourced from PubChem (CID 87991691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).