About pyridine;4-(2-pyridin-4-ylethenyl)benzaldehyde
pyridine;4-(2-pyridin-4-ylethenyl)benzaldehyde (PubChem CID 87992660) has the molecular formula C19H16N2O
and a molecular weight of 288.35 g/mol. Its IUPAC name is pyridine;4-(2-pyridin-4-ylethenyl)benzaldehyde.
Molecular Properties
| Compound Name | pyridine;4-(2-pyridin-4-ylethenyl)benzaldehyde |
| PubChem CID | 87992660 |
| Molecular Formula | C19H16N2O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | pyridine;4-(2-pyridin-4-ylethenyl)benzaldehyde |
| SMILES | O=Cc1ccc(C=Cc2ccncc2)cc1.c1ccncc1 |
| InChI | InChI=1S/C14H11NO.C5H5N/c16-11-14-5-3-12(4-6-14)1-2-13-7-9-15-10-8-13;1-2-4-6-5-3-1/h1-11H;1-5H |
| InChIKey | QDLOFWNHLBYYIR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze pyridine;4-(2-pyridin-4-ylethenyl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine;4-(2-pyridin-4-ylethenyl)benzaldehyde?
The IUPAC name of pyridine;4-(2-pyridin-4-ylethenyl)benzaldehyde (CID 87992660) is pyridine;4-(2-pyridin-4-ylethenyl)benzaldehyde.
What is the SMILES notation for pyridine;4-(2-pyridin-4-ylethenyl)benzaldehyde?
The canonical SMILES for pyridine;4-(2-pyridin-4-ylethenyl)benzaldehyde is O=Cc1ccc(C=Cc2ccncc2)cc1.c1ccncc1.
What is the InChIKey of pyridine;4-(2-pyridin-4-ylethenyl)benzaldehyde?
The InChIKey is QDLOFWNHLBYYIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO.C5H5N/c16-11-14-5-3-12(4-6-14)1-2-13-7-9-15-10-8-13;1-2-4-6-5-3-1/h1-11H;1-5H.
What are the key properties of pyridine;4-(2-pyridin-4-ylethenyl)benzaldehyde?
pyridine;4-(2-pyridin-4-ylethenyl)benzaldehyde has a molecular weight of 288.35 g/mol, XLogP of 4.15, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine;4-(2-pyridin-4-ylethenyl)benzaldehyde is sourced from PubChem (CID 87992660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).