C18H20O2Si — CID 87993708
2-[4-(1,1-dimethyl-6H-indeno[1,2-b]siliren-2-yl)cyclopenta-1,4-dien-1-yl]oxyethanol (PubChem CID 87993708) has the molecular formula C18H20O2Si and a molecular weight of 296.44 g/mol. Its IUPAC name is 2-[4-(1,1-dimethyl-6H-indeno[1,2-b]siliren-2-yl)cyclopenta-1,4-dien-1-yl]oxyethanol.
| Compound Name | 2-[4-(1,1-dimethyl-6H-indeno[1,2-b]siliren-2-yl)cyclopenta-1,4-dien-1-yl]oxyethanol |
|---|---|
| PubChem CID | 87993708 |
| Molecular Formula | C18H20O2Si |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-[4-(1,1-dimethyl-6H-indeno[1,2-b]siliren-2-yl)cyclopenta-1,4-dien-1-yl]oxyethanol |
| SMILES | C[Si]1(C)C2=C1c1c(cccc1C1=CC(OCCO)=CC1)C2 |
| InChI | InChI=1S/C18H20O2Si/c1-21(2)16-11-13-4-3-5-15(17(13)18(16)21)12-6-7-14(10-12)20-9-8-19/h3-5,7,10,19H,6,8-9,11H2,1-2H3 |
| InChIKey | HKSWTSYLSHIQRS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|