4,4-diethyloct-2-enoic acid

C12H22O2 — CID 87994027

IUPAC4,4-diethyloct-2-enoic acid
SMILESCCCCC(C=CC(=O)O)(CC)CC
InChIInChI=1S/C12H22O2/c1-4-7-9-12(5-2,6-3)10-8-11(13)14/h8,10H,4-7,9H2,1-3H3,(H,13,14)
InChIKeyOLXKYJPQVDMLAA-UHFFFAOYSA-N
MW198.31 g/mol
LogP3.62
Rot. Bonds7

About 4,4-diethyloct-2-enoic acid

4,4-diethyloct-2-enoic acid (PubChem CID 87994027) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 4,4-diethyloct-2-enoic acid.

Molecular Properties

Compound Name4,4-diethyloct-2-enoic acid
PubChem CID87994027
Molecular FormulaC12H22O2
Molecular Weight198.31 g/mol
Exact Mass198.16
IUPAC Name4,4-diethyloct-2-enoic acid
SMILESCCCCC(C=CC(=O)O)(CC)CC
InChIInChI=1S/C12H22O2/c1-4-7-9-12(5-2,6-3)10-8-11(13)14/h8,10H,4-7,9H2,1-3H3,(H,13,14)
InChIKeyOLXKYJPQVDMLAA-UHFFFAOYSA-N
XLogP3.62
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds7
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.31
LogP ≤ 53.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4,4-diethyloct-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,4-diethyloct-2-enoic acid?
The IUPAC name of 4,4-diethyloct-2-enoic acid (CID 87994027) is 4,4-diethyloct-2-enoic acid.
What is the SMILES notation for 4,4-diethyloct-2-enoic acid?
The canonical SMILES for 4,4-diethyloct-2-enoic acid is CCCCC(C=CC(=O)O)(CC)CC.
What is the InChIKey of 4,4-diethyloct-2-enoic acid?
The InChIKey is OLXKYJPQVDMLAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-4-7-9-12(5-2,6-3)10-8-11(13)14/h8,10H,4-7,9H2,1-3H3,(H,13,14).
What are the key properties of 4,4-diethyloct-2-enoic acid?
4,4-diethyloct-2-enoic acid has a molecular weight of 198.31 g/mol, XLogP of 3.62, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-diethyloct-2-enoic acid is sourced from PubChem (CID 87994027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).