C26H33N5O3S — CID 87995825
1-(2,4-dimethoxyphenyl)-3-[4-[[4-(dimethylamino)quinolin-2-yl]amino]cyclohexyl]-1-sulfanylurea (PubChem CID 87995825) has the molecular formula C26H33N5O3S and a molecular weight of 495.65 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-[4-[[4-(dimethylamino)quinolin-2-yl]amino]cyclohexyl]-1-sulfanylurea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-[4-[[4-(dimethylamino)quinolin-2-yl]amino]cyclohexyl]-1-sulfanylurea |
|---|---|
| PubChem CID | 87995825 |
| Molecular Formula | C26H33N5O3S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-[4-[[4-(dimethylamino)quinolin-2-yl]amino]cyclohexyl]-1-sulfanylurea |
| SMILES | COc1ccc(N(S)C(=O)NC2CCC(Nc3cc(N(C)C)c4ccccc4n3)CC2)c(OC)c1 |
| InChI | InChI=1S/C26H33N5O3S/c1-30(2)23-16-25(29-21-8-6-5-7-20(21)23)27-17-9-11-18(12-10-17)28-26(32)31(35)22-14-13-19(33-3)15-24(22)34-4/h5-8,13-18,35H,9-12H2,1-4H3,(H,27,29)(H,28,32) |
| InChIKey | VSAGUODJFFASMA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|