C12H5Br4FO — CID 87997312
1,3,5-tribromo-2-(3-bromophenoxy)-4-fluorobenzene (PubChem CID 87997312) has the molecular formula C12H5Br4FO and a molecular weight of 503.79 g/mol. Its IUPAC name is 1,3,5-tribromo-2-(3-bromophenoxy)-4-fluorobenzene.
| Compound Name | 1,3,5-tribromo-2-(3-bromophenoxy)-4-fluorobenzene |
|---|---|
| PubChem CID | 87997312 |
| Molecular Formula | C12H5Br4FO |
| Molecular Weight | 503.79 g/mol |
| Exact Mass | 499.71 |
| IUPAC Name | 1,3,5-tribromo-2-(3-bromophenoxy)-4-fluorobenzene |
| SMILES | Fc1c(Br)cc(Br)c(Oc2cccc(Br)c2)c1Br |
| InChI | InChI=1S/C12H5Br4FO/c13-6-2-1-3-7(4-6)18-12-9(15)5-8(14)11(17)10(12)16/h1-5H |
| InChIKey | LHIWTKSINUWYMW-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.79 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|